C27H60N10O4 — CID 144623908
N-(2-aminoethyl)-4-[2-[bis[4-(2-aminoethylamino)-4-oxobutyl]amino]ethyl-(4-oxobutyl)amino]butanamide;N'-methylethane-1,2-diamine (PubChem CID 144623908) has the molecular formula C27H60N10O4 and a molecular weight of 588.84 g/mol. Its IUPAC name is N-(2-aminoethyl)-4-[2-[bis[4-(2-aminoethylamino)-4-oxobutyl]amino]ethyl-(4-oxobutyl)amino]butanamide;N'-methylethane-1,2-diamine.
| Compound Name | N-(2-aminoethyl)-4-[2-[bis[4-(2-aminoethylamino)-4-oxobutyl]amino]ethyl-(4-oxobutyl)amino]butanamide;N'-methylethane-1,2-diamine |
|---|---|
| PubChem CID | 144623908 |
| Molecular Formula | C27H60N10O4 |
| Molecular Weight | 588.84 g/mol |
| Exact Mass | 588.48 |
| IUPAC Name | N-(2-aminoethyl)-4-[2-[bis[4-(2-aminoethylamino)-4-oxobutyl]amino]ethyl-(4-oxobutyl)amino]butanamide;N'-methylethane-1,2-diamine |
| SMILES | CNCCN.NCCNC(=O)CCCN(CCCC=O)CCN(CCCC(=O)NCCN)CCCC(=O)NCCN |
| InChI | InChI=1S/C24H50N8O4.C3H10N2/c25-9-12-28-22(34)6-3-16-31(15-1-2-21-33)19-20-32(17-4-7-23(35)29-13-10-26)18-5-8-24(36)30-14-11-27;1-5-3-2-4/h21H,1-20,25-27H2,(H,28,34)(H,29,35)(H,30,36);5H,2-4H2,1H3 |
| InChIKey | JUTCZAMZLDSHOG-UHFFFAOYSA-N |
| XLogP | -2.70 |
| TPSA | 226.96 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 27 |
| Heavy Atoms | 41 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.84 |
| LogP ≤ 5 | -2.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|