C27H32N2O3S — CID 144626047
2-benzyl-4-hydroxy-N-(2-hydroxy-2,3,4,5-tetrahydro-1H-inden-1-yl)-5-(phenylsulfanylamino)pentanamide (PubChem CID 144626047) has the molecular formula C27H32N2O3S and a molecular weight of 464.63 g/mol. Its IUPAC name is 2-benzyl-4-hydroxy-N-(2-hydroxy-2,3,4,5-tetrahydro-1H-inden-1-yl)-5-(phenylsulfanylamino)pentanamide.
| Compound Name | 2-benzyl-4-hydroxy-N-(2-hydroxy-2,3,4,5-tetrahydro-1H-inden-1-yl)-5-(phenylsulfanylamino)pentanamide |
|---|---|
| PubChem CID | 144626047 |
| Molecular Formula | C27H32N2O3S |
| Molecular Weight | 464.63 g/mol |
| Exact Mass | 464.21 |
| IUPAC Name | 2-benzyl-4-hydroxy-N-(2-hydroxy-2,3,4,5-tetrahydro-1H-inden-1-yl)-5-(phenylsulfanylamino)pentanamide |
| SMILES | O=C(NC1C2=C(CCC=C2)CC1O)C(Cc1ccccc1)CC(O)CNSc1ccccc1 |
| InChI | InChI=1S/C27H32N2O3S/c30-22(18-28-33-23-12-5-2-6-13-23)16-21(15-19-9-3-1-4-10-19)27(32)29-26-24-14-8-7-11-20(24)17-25(26)31/h1-6,8-10,12-14,21-22,25-26,28,30-31H,7,11,15-18H2,(H,29,32) |
| InChIKey | SSWUEADBADGVQO-UHFFFAOYSA-N |
| XLogP | 3.79 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.63 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|