C29H34N2O6S — CID 144626203
(2R,4S)-5-[(4-acetylphenyl)sulfonylamino]-2-benzyl-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3,6,7-tetrahydro-1H-inden-1-yl]pentanamide (PubChem CID 144626203) has the molecular formula C29H34N2O6S and a molecular weight of 538.67 g/mol. Its IUPAC name is (2R,4S)-5-[(4-acetylphenyl)sulfonylamino]-2-benzyl-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3,6,7-tetrahydro-1H-inden-1-yl]pentanamide.
| Compound Name | (2R,4S)-5-[(4-acetylphenyl)sulfonylamino]-2-benzyl-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3,6,7-tetrahydro-1H-inden-1-yl]pentanamide |
|---|---|
| PubChem CID | 144626203 |
| Molecular Formula | C29H34N2O6S |
| Molecular Weight | 538.67 g/mol |
| Exact Mass | 538.21 |
| IUPAC Name | (2R,4S)-5-[(4-acetylphenyl)sulfonylamino]-2-benzyl-4-hydroxy-N-[(1S,2R)-2-hydroxy-2,3,6,7-tetrahydro-1H-inden-1-yl]pentanamide |
| SMILES | CC(=O)c1ccc(S(=O)(=O)NC[C@@H](O)C[C@@H](Cc2ccccc2)C(=O)N[C@H]2C3=C(C=CCC3)C[C@H]2O)cc1 |
| InChI | InChI=1S/C29H34N2O6S/c1-19(32)21-11-13-25(14-12-21)38(36,37)30-18-24(33)16-23(15-20-7-3-2-4-8-20)29(35)31-28-26-10-6-5-9-22(26)17-27(28)34/h2-5,7-9,11-14,23-24,27-28,30,33-34H,6,10,15-18H2,1H3,(H,31,35)/t23-,24+,27-,28+/m1/s1 |
| InChIKey | KBLDZSOWQCPDEQ-CUFBHMEESA-N |
| XLogP | 2.67 |
| TPSA | 132.80 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.67 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |