C28H33ClN2O5S — CID 118337803
(2R,4S)-2-benzyl-5-[(4-chlorophenyl)sulfonylamino]-4-hydroxy-N-[(1S,3Z,5Z,9R)-9-hydroxy-7-methylidenecyclonona-3,5-dien-1-yl]pentanamide (PubChem CID 118337803) has the molecular formula C28H33ClN2O5S and a molecular weight of 545.10 g/mol. Its IUPAC name is (2R,4S)-2-benzyl-5-[(4-chlorophenyl)sulfonylamino]-4-hydroxy-N-[(1S,3Z,5Z,9R)-9-hydroxy-7-methylidenecyclonona-3,5-dien-1-yl]pentanamide.
| Compound Name | (2R,4S)-2-benzyl-5-[(4-chlorophenyl)sulfonylamino]-4-hydroxy-N-[(1S,3Z,5Z,9R)-9-hydroxy-7-methylidenecyclonona-3,5-dien-1-yl]pentanamide |
|---|---|
| PubChem CID | 118337803 |
| Molecular Formula | C28H33ClN2O5S |
| Molecular Weight | 545.10 g/mol |
| Exact Mass | 544.18 |
| IUPAC Name | (2R,4S)-2-benzyl-5-[(4-chlorophenyl)sulfonylamino]-4-hydroxy-N-[(1S,3Z,5Z,9R)-9-hydroxy-7-methylidenecyclonona-3,5-dien-1-yl]pentanamide |
| SMILES | C=C1/C=C\C=C/C[C@H](NC(=O)[C@H](Cc2ccccc2)C[C@H](O)CNS(=O)(=O)c2ccc(Cl)cc2)[C@H](O)C1 |
| InChI | InChI=1S/C28H33ClN2O5S/c1-20-8-4-2-7-11-26(27(33)16-20)31-28(34)22(17-21-9-5-3-6-10-21)18-24(32)19-30-37(35,36)25-14-12-23(29)13-15-25/h2-10,12-15,22,24,26-27,30,32-33H,1,11,16-19H2,(H,31,34)/b7-2-,8-4-/t22-,24+,26+,27-/m1/s1 |
| InChIKey | HRQDKUZFSCYMNS-LFGPEOKOSA-N |
| XLogP | 3.54 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.10 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |