C27H37BrN2O4 — CID 90154965
(2R,4S)-2-benzyl-5-(5-bromopentanoylamino)-4-hydroxy-N-[(1S,3Z,5Z,9R)-9-hydroxy-7-methylidenecyclonona-3,5-dien-1-yl]pentanamide (PubChem CID 90154965) has the molecular formula C27H37BrN2O4 and a molecular weight of 533.51 g/mol. Its IUPAC name is (2R,4S)-2-benzyl-5-(5-bromopentanoylamino)-4-hydroxy-N-[(1S,3Z,5Z,9R)-9-hydroxy-7-methylidenecyclonona-3,5-dien-1-yl]pentanamide.
| Compound Name | (2R,4S)-2-benzyl-5-(5-bromopentanoylamino)-4-hydroxy-N-[(1S,3Z,5Z,9R)-9-hydroxy-7-methylidenecyclonona-3,5-dien-1-yl]pentanamide |
|---|---|
| PubChem CID | 90154965 |
| Molecular Formula | C27H37BrN2O4 |
| Molecular Weight | 533.51 g/mol |
| Exact Mass | 532.19 |
| IUPAC Name | (2R,4S)-2-benzyl-5-(5-bromopentanoylamino)-4-hydroxy-N-[(1S,3Z,5Z,9R)-9-hydroxy-7-methylidenecyclonona-3,5-dien-1-yl]pentanamide |
| SMILES | C=C1/C=C\C=C/C[C@H](NC(=O)[C@H](Cc2ccccc2)C[C@H](O)CNC(=O)CCCCBr)[C@H](O)C1 |
| InChI | InChI=1S/C27H37BrN2O4/c1-20-10-4-2-7-13-24(25(32)16-20)30-27(34)22(17-21-11-5-3-6-12-21)18-23(31)19-29-26(33)14-8-9-15-28/h2-7,10-12,22-25,31-32H,1,8-9,13-19H2,(H,29,33)(H,30,34)/b7-2-,10-4-/t22-,23+,24+,25-/m1/s1 |
| InChIKey | BTMALJKFGWQHMO-ODBLUSLMSA-N |
| XLogP | 3.59 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.51 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|