C24H29NO2S — CID 144627661
2,3-dimethylbut-2-enoic acid;3-ethyl-1-benzothiophene;3-prop-1-en-2-ylpyridine (PubChem CID 144627661) has the molecular formula C24H29NO2S and a molecular weight of 395.57 g/mol. Its IUPAC name is 2,3-dimethylbut-2-enoic acid;3-ethyl-1-benzothiophene;3-prop-1-en-2-ylpyridine.
| Compound Name | 2,3-dimethylbut-2-enoic acid;3-ethyl-1-benzothiophene;3-prop-1-en-2-ylpyridine |
|---|---|
| PubChem CID | 144627661 |
| Molecular Formula | C24H29NO2S |
| Molecular Weight | 395.57 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 2,3-dimethylbut-2-enoic acid;3-ethyl-1-benzothiophene;3-prop-1-en-2-ylpyridine |
| SMILES | C=C(C)c1cccnc1.CC(C)=C(C)C(=O)O.CCc1csc2ccccc12 |
| InChI | InChI=1S/C10H10S.C8H9N.C6H10O2/c1-2-8-7-11-10-6-4-3-5-9(8)10;1-7(2)8-4-3-5-9-6-8;1-4(2)5(3)6(7)8/h3-7H,2H2,1H3;3-6H,1H2,2H3;1-3H3,(H,7,8) |
| InChIKey | YONZMOUCYBXTQX-UHFFFAOYSA-N |
| XLogP | 7.01 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.57 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|