C19H19BrFNO3 — CID 144628582
(E)-1-[(2-bromo-4-fluoro-7-methoxy-9H-xanthen-9-yl)methoxy]but-1-en-1-amine (PubChem CID 144628582) has the molecular formula C19H19BrFNO3 and a molecular weight of 408.27 g/mol. Its IUPAC name is (E)-1-[(2-bromo-4-fluoro-7-methoxy-9H-xanthen-9-yl)methoxy]but-1-en-1-amine.
| Compound Name | (E)-1-[(2-bromo-4-fluoro-7-methoxy-9H-xanthen-9-yl)methoxy]but-1-en-1-amine |
|---|---|
| PubChem CID | 144628582 |
| Molecular Formula | C19H19BrFNO3 |
| Molecular Weight | 408.27 g/mol |
| Exact Mass | 407.05 |
| IUPAC Name | (E)-1-[(2-bromo-4-fluoro-7-methoxy-9H-xanthen-9-yl)methoxy]but-1-en-1-amine |
| SMILES | CC/C=C(\N)OCC1c2cc(OC)ccc2Oc2c(F)cc(Br)cc21 |
| InChI | InChI=1S/C19H19BrFNO3/c1-3-4-18(22)24-10-15-13-9-12(23-2)5-6-17(13)25-19-14(15)7-11(20)8-16(19)21/h4-9,15H,3,10,22H2,1-2H3/b18-4+ |
| InChIKey | SIRBYANHBFUUIJ-JJPRUIFNSA-N |
| XLogP | 5.06 |
| TPSA | 53.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.27 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'} |
|---|