About ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate
ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate (PubChem CID 144631010) has the molecular formula C12H13ClN2OS
and a molecular weight of 268.77 g/mol. Its IUPAC name is ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate.
Molecular Properties
| Compound Name | ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate |
| PubChem CID | 144631010 |
| Molecular Formula | C12H13ClN2OS |
| Molecular Weight | 268.77 g/mol |
| Exact Mass | 268.04 |
| IUPAC Name | ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate |
| SMILES | C=CS/C(=N\C)NC(=O)Cc1cccc(Cl)c1 |
| InChI | InChI=1S/C12H13ClN2OS/c1-3-17-12(14-2)15-11(16)8-9-5-4-6-10(13)7-9/h3-7H,1,8H2,2H3,(H,14,15,16) |
| InChIKey | KAHXGSMXYVFUKW-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 41.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.77 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate?
The IUPAC name of ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate (CID 144631010) is ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate.
What is the SMILES notation for ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate?
The canonical SMILES for ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate is C=CS/C(=N\C)NC(=O)Cc1cccc(Cl)c1.
What is the InChIKey of ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate?
The InChIKey is KAHXGSMXYVFUKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13ClN2OS/c1-3-17-12(14-2)15-11(16)8-9-5-4-6-10(13)7-9/h3-7H,1,8H2,2H3,(H,14,15,16).
What are the key properties of ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate?
ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate has a molecular weight of 268.77 g/mol, XLogP of 2.86, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethenyl N-[2-(3-chlorophenyl)acetyl]-N'-methylcarbamimidothioate is sourced from PubChem (CID 144631010), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).