C14H19N5O — CID 144636179
[(3R)-3-aminopiperidin-1-yl]-[2-[bis(methylideneamino)amino]phenyl]methanone (PubChem CID 144636179) has the molecular formula C14H19N5O and a molecular weight of 273.34 g/mol. Its IUPAC name is [(3R)-3-aminopiperidin-1-yl]-[2-[bis(methylideneamino)amino]phenyl]methanone.
| Compound Name | [(3R)-3-aminopiperidin-1-yl]-[2-[bis(methylideneamino)amino]phenyl]methanone |
|---|---|
| PubChem CID | 144636179 |
| Molecular Formula | C14H19N5O |
| Molecular Weight | 273.34 g/mol |
| Exact Mass | 273.16 |
| IUPAC Name | [(3R)-3-aminopiperidin-1-yl]-[2-[bis(methylideneamino)amino]phenyl]methanone |
| SMILES | C=NN(N=C)c1ccccc1C(=O)N1CCC[C@@H](N)C1 |
| InChI | InChI=1S/C14H19N5O/c1-16-19(17-2)13-8-4-3-7-12(13)14(20)18-9-5-6-11(15)10-18/h3-4,7-8,11H,1-2,5-6,9-10,15H2/t11-/m1/s1 |
| InChIKey | MRKMLWPZPYNLNY-LLVKDONJSA-N |
| XLogP | 1.29 |
| TPSA | 74.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.34 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|