C23H36N4O4 — CID 144636410
ethane;(3S)-3-[[2-(methylamino)acetyl]amino]-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide;1,2,3,4-tetrahydronaphthalene (PubChem CID 144636410) has the molecular formula C23H36N4O4 and a molecular weight of 432.57 g/mol. Its IUPAC name is ethane;(3S)-3-[[2-(methylamino)acetyl]amino]-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide;1,2,3,4-tetrahydronaphthalene.
| Compound Name | ethane;(3S)-3-[[2-(methylamino)acetyl]amino]-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide;1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 144636410 |
| Molecular Formula | C23H36N4O4 |
| Molecular Weight | 432.57 g/mol |
| Exact Mass | 432.27 |
| IUPAC Name | ethane;(3S)-3-[[2-(methylamino)acetyl]amino]-4-oxo-2,3,6,7,8,8a-hexahydropyrrolo[2,1-b][1,3]oxazine-6-carboxamide;1,2,3,4-tetrahydronaphthalene |
| SMILES | CC.CNCC(=O)N[C@H]1COC2CCC(C(N)=O)N2C1=O.c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C11H18N4O4.C10H12.C2H6/c1-13-4-8(16)14-6-5-19-9-3-2-7(10(12)17)15(9)11(6)18;1-2-6-10-8-4-3-7-9(10)5-1;1-2/h6-7,9,13H,2-5H2,1H3,(H2,12,17)(H,14,16);1-2,5-6H,3-4,7-8H2;1-2H3/t6-,7?,9?;;/m0../s1 |
| InChIKey | NUCYVUQZQDRSFB-IITPSBIRSA-N |
| XLogP | 1.11 |
| TPSA | 113.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.57 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |