C21H29N5O3 — CID 144973546
ethane;8-[[2-(methylamino)acetyl]amino]-7-oxo-6,17-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),11,13,15-tetraene-5-carboxamide (PubChem CID 144973546) has the molecular formula C21H29N5O3 and a molecular weight of 399.50 g/mol. Its IUPAC name is ethane;8-[[2-(methylamino)acetyl]amino]-7-oxo-6,17-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),11,13,15-tetraene-5-carboxamide.
| Compound Name | ethane;8-[[2-(methylamino)acetyl]amino]-7-oxo-6,17-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),11,13,15-tetraene-5-carboxamide |
|---|---|
| PubChem CID | 144973546 |
| Molecular Formula | C21H29N5O3 |
| Molecular Weight | 399.50 g/mol |
| Exact Mass | 399.23 |
| IUPAC Name | ethane;8-[[2-(methylamino)acetyl]amino]-7-oxo-6,17-diazatetracyclo[8.7.0.02,6.011,16]heptadeca-1(10),11,13,15-tetraene-5-carboxamide |
| SMILES | CC.CNCC(=O)NC1Cc2c([nH]c3ccccc23)C2CCC(C(N)=O)N2C1=O |
| InChI | InChI=1S/C19H23N5O3.C2H6/c1-21-9-16(25)22-13-8-11-10-4-2-3-5-12(10)23-17(11)14-6-7-15(18(20)26)24(14)19(13)27;1-2/h2-5,13-15,21,23H,6-9H2,1H3,(H2,20,26)(H,22,25);1-2H3 |
| InChIKey | PTEFRDMIXSTOGO-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.50 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|