C30H39N5O3 — CID 144973523
1-formyl-5-[3-[2-[[2-(methylamino)acetyl]amino]propyl]-1H-indol-2-yl]pyrrolidine-2-carboxamide;1,2,3,4-tetrahydronaphthalene (PubChem CID 144973523) has the molecular formula C30H39N5O3 and a molecular weight of 517.67 g/mol. Its IUPAC name is 1-formyl-5-[3-[2-[[2-(methylamino)acetyl]amino]propyl]-1H-indol-2-yl]pyrrolidine-2-carboxamide;1,2,3,4-tetrahydronaphthalene.
| Compound Name | 1-formyl-5-[3-[2-[[2-(methylamino)acetyl]amino]propyl]-1H-indol-2-yl]pyrrolidine-2-carboxamide;1,2,3,4-tetrahydronaphthalene |
|---|---|
| PubChem CID | 144973523 |
| Molecular Formula | C30H39N5O3 |
| Molecular Weight | 517.67 g/mol |
| Exact Mass | 517.31 |
| IUPAC Name | 1-formyl-5-[3-[2-[[2-(methylamino)acetyl]amino]propyl]-1H-indol-2-yl]pyrrolidine-2-carboxamide;1,2,3,4-tetrahydronaphthalene |
| SMILES | CNCC(=O)NC(C)Cc1c(C2CCC(C(N)=O)N2C=O)[nH]c2ccccc12.c1ccc2c(c1)CCCC2 |
| InChI | InChI=1S/C20H27N5O3.C10H12/c1-12(23-18(27)10-22-2)9-14-13-5-3-4-6-15(13)24-19(14)16-7-8-17(20(21)28)25(16)11-26;1-2-6-10-8-4-3-7-9(10)5-1/h3-6,11-12,16-17,22,24H,7-10H2,1-2H3,(H2,21,28)(H,23,27);1-2,5-6H,3-4,7-8H2 |
| InChIKey | FMZLFXNTQSDHGH-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 120.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.67 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|