C40H33N — CID 144640069
(15E,17Z)-26,26-dimethyl-10-[3-(4-methylphenyl)phenyl]-14-azapentacyclo[17.7.0.02,7.08,13.020,25]hexacosa-1(19),2,4,6,8(13),9,11,15,17,20,22,24-dodecaene (PubChem CID 144640069) has the molecular formula C40H33N and a molecular weight of 527.71 g/mol. Its IUPAC name is (15E,17Z)-26,26-dimethyl-10-[3-(4-methylphenyl)phenyl]-14-azapentacyclo[17.7.0.02,7.08,13.020,25]hexacosa-1(19),2,4,6,8(13),9,11,15,17,20,22,24-dodecaene.
| Compound Name | (15E,17Z)-26,26-dimethyl-10-[3-(4-methylphenyl)phenyl]-14-azapentacyclo[17.7.0.02,7.08,13.020,25]hexacosa-1(19),2,4,6,8(13),9,11,15,17,20,22,24-dodecaene |
|---|---|
| PubChem CID | 144640069 |
| Molecular Formula | C40H33N |
| Molecular Weight | 527.71 g/mol |
| Exact Mass | 527.26 |
| IUPAC Name | (15E,17Z)-26,26-dimethyl-10-[3-(4-methylphenyl)phenyl]-14-azapentacyclo[17.7.0.02,7.08,13.020,25]hexacosa-1(19),2,4,6,8(13),9,11,15,17,20,22,24-dodecaene |
| SMILES | Cc1ccc(-c2cccc(-c3ccc4c(c3)-c3ccccc3C3=C(/C=C\C=C/N4)c4ccccc4C3(C)C)c2)cc1 |
| InChI | InChI=1S/C40H33N/c1-27-18-20-28(21-19-27)29-11-10-12-30(25-29)31-22-23-38-36(26-31)32-13-4-5-15-34(32)39-35(16-8-9-24-41-38)33-14-6-7-17-37(33)40(39,2)3/h4-26,41H,1-3H3/b16-8-,24-9- |
| InChIKey | IUUIFPVIHUPEFL-XYJSBEJRSA-N |
| XLogP | 10.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.71 |
| LogP ≤ 5 | 10.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|