C30H39F3N6O2 — CID 144640787
2-[4-(6-amino-5-ethanimidoyl-3-pyridinyl)phenoxy]acetaldehyde;ethane;N-methyl-4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)aniline (PubChem CID 144640787) has the molecular formula C30H39F3N6O2 and a molecular weight of 572.68 g/mol. Its IUPAC name is 2-[4-(6-amino-5-ethanimidoyl-3-pyridinyl)phenoxy]acetaldehyde;ethane;N-methyl-4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)aniline.
| Compound Name | 2-[4-(6-amino-5-ethanimidoyl-3-pyridinyl)phenoxy]acetaldehyde;ethane;N-methyl-4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 144640787 |
| Molecular Formula | C30H39F3N6O2 |
| Molecular Weight | 572.68 g/mol |
| Exact Mass | 572.31 |
| IUPAC Name | 2-[4-(6-amino-5-ethanimidoyl-3-pyridinyl)phenoxy]acetaldehyde;ethane;N-methyl-4-(piperazin-1-ylmethyl)-3-(trifluoromethyl)aniline |
| SMILES | CC.CNc1ccc(CN2CCNCC2)c(C(F)(F)F)c1.[H]/N=C(\C)c1cc(-c2ccc(OCC=O)cc2)cnc1N |
| InChI | InChI=1S/C15H15N3O2.C13H18F3N3.C2H6/c1-10(16)14-8-12(9-18-15(14)17)11-2-4-13(5-3-11)20-7-6-19;1-17-11-3-2-10(12(8-11)13(14,15)16)9-19-6-4-18-5-7-19;1-2/h2-6,8-9,16H,7H2,1H3,(H2,17,18);2-3,8,17-18H,4-7,9H2,1H3;1-2H3/b16-10+;; |
| InChIKey | WUKOIYVSCISDBB-CNSDMJOKSA-N |
| XLogP | 5.47 |
| TPSA | 116.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.68 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|