C52H103NO6 — CID 144641440
1-(3-methoxypropyl)pyrrolidine;(5-methyl-2-propan-2-ylhexyl) 10-formylnonadecanoate;3-pentyloctyl formate (PubChem CID 144641440) has the molecular formula C52H103NO6 and a molecular weight of 838.40 g/mol. Its IUPAC name is 1-(3-methoxypropyl)pyrrolidine;(5-methyl-2-propan-2-ylhexyl) 10-formylnonadecanoate;3-pentyloctyl formate.
| Compound Name | 1-(3-methoxypropyl)pyrrolidine;(5-methyl-2-propan-2-ylhexyl) 10-formylnonadecanoate;3-pentyloctyl formate |
|---|---|
| PubChem CID | 144641440 |
| Molecular Formula | C52H103NO6 |
| Molecular Weight | 838.40 g/mol |
| Exact Mass | 837.78 |
| IUPAC Name | 1-(3-methoxypropyl)pyrrolidine;(5-methyl-2-propan-2-ylhexyl) 10-formylnonadecanoate;3-pentyloctyl formate |
| SMILES | CCCCCC(CCCCC)CCOC=O.CCCCCCCCCC(C=O)CCCCCCCCC(=O)OCC(CCC(C)C)C(C)C.COCCCN1CCCC1 |
| InChI | InChI=1S/C30H58O3.C14H28O2.C8H17NO/c1-6-7-8-9-10-13-16-19-28(24-31)20-17-14-11-12-15-18-21-30(32)33-25-29(27(4)5)23-22-26(2)3;1-3-5-7-9-14(10-8-6-4-2)11-12-16-13-15;1-10-8-4-7-9-5-2-3-6-9/h24,26-29H,6-23,25H2,1-5H3;13-14H,3-12H2,1-2H3;2-8H2,1H3 |
| InChIKey | VFALSUMRYZWXEV-UHFFFAOYSA-N |
| XLogP | 14.76 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 40 |
| Heavy Atoms | 59 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 838.40 |
| LogP ≤ 5 | 14.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|