C51H99NO4 — CID 164735931
bis(5-methyl-2-propan-2-ylhexyl) 11-methyl-11-(5-pyrrolidin-1-ylpentyl)henicosanedioate (PubChem CID 164735931) has the molecular formula C51H99NO4 and a molecular weight of 790.36 g/mol. Its IUPAC name is bis(5-methyl-2-propan-2-ylhexyl) 11-methyl-11-(5-pyrrolidin-1-ylpentyl)henicosanedioate.
| Compound Name | bis(5-methyl-2-propan-2-ylhexyl) 11-methyl-11-(5-pyrrolidin-1-ylpentyl)henicosanedioate |
|---|---|
| PubChem CID | 164735931 |
| Molecular Formula | C51H99NO4 |
| Molecular Weight | 790.36 g/mol |
| Exact Mass | 789.76 |
| IUPAC Name | bis(5-methyl-2-propan-2-ylhexyl) 11-methyl-11-(5-pyrrolidin-1-ylpentyl)henicosanedioate |
| SMILES | CC(C)CCC(COC(=O)CCCCCCCCCC(C)(CCCCCCCCCC(=O)OCC(CCC(C)C)C(C)C)CCCCCN1CCCC1)C(C)C |
| InChI | InChI=1S/C51H99NO4/c1-43(2)31-33-47(45(5)6)41-55-49(53)29-21-16-12-10-14-18-23-35-51(9,37-25-20-26-38-52-39-27-28-40-52)36-24-19-15-11-13-17-22-30-50(54)56-42-48(46(7)8)34-32-44(3)4/h43-48H,10-42H2,1-9H3 |
| InChIKey | NKISCWCXLFKMPP-UHFFFAOYSA-N |
| XLogP | 15.17 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 38 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 790.36 |
| LogP ≤ 5 | 15.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|