C50H97N3O5 — CID 164735891
bis(5-methyl-2-propan-2-ylhexyl) 11-methyl-11-[3-(4-methylpiperazin-1-yl)propanoylamino]henicosanedioate (PubChem CID 164735891) has the molecular formula C50H97N3O5 and a molecular weight of 820.34 g/mol. Its IUPAC name is bis(5-methyl-2-propan-2-ylhexyl) 11-methyl-11-[3-(4-methylpiperazin-1-yl)propanoylamino]henicosanedioate.
| Compound Name | bis(5-methyl-2-propan-2-ylhexyl) 11-methyl-11-[3-(4-methylpiperazin-1-yl)propanoylamino]henicosanedioate |
|---|---|
| PubChem CID | 164735891 |
| Molecular Formula | C50H97N3O5 |
| Molecular Weight | 820.34 g/mol |
| Exact Mass | 819.74 |
| IUPAC Name | bis(5-methyl-2-propan-2-ylhexyl) 11-methyl-11-[3-(4-methylpiperazin-1-yl)propanoylamino]henicosanedioate |
| SMILES | CC(C)CCC(COC(=O)CCCCCCCCCC(C)(CCCCCCCCCC(=O)OCC(CCC(C)C)C(C)C)NC(=O)CCN1CCN(C)CC1)C(C)C |
| InChI | InChI=1S/C50H97N3O5/c1-41(2)27-29-45(43(5)6)39-57-48(55)25-21-17-13-11-15-19-23-32-50(9,51-47(54)31-34-53-37-35-52(10)36-38-53)33-24-20-16-12-14-18-22-26-49(56)58-40-46(44(7)8)30-28-42(3)4/h41-46H,11-40H2,1-10H3,(H,51,54) |
| InChIKey | QOORGVIRANNHFD-UHFFFAOYSA-N |
| XLogP | 12.02 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 820.34 |
| LogP ≤ 5 | 12.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|