C49H94N2O5 — CID 164735926
bis(5-methyl-2-propan-2-ylhexyl) 11-methyl-11-(3-pyrrolidin-1-ylpropanoylamino)henicosanedioate (PubChem CID 164735926) has the molecular formula C49H94N2O5 and a molecular weight of 791.30 g/mol. Its IUPAC name is bis(5-methyl-2-propan-2-ylhexyl) 11-methyl-11-(3-pyrrolidin-1-ylpropanoylamino)henicosanedioate.
| Compound Name | bis(5-methyl-2-propan-2-ylhexyl) 11-methyl-11-(3-pyrrolidin-1-ylpropanoylamino)henicosanedioate |
|---|---|
| PubChem CID | 164735926 |
| Molecular Formula | C49H94N2O5 |
| Molecular Weight | 791.30 g/mol |
| Exact Mass | 790.72 |
| IUPAC Name | bis(5-methyl-2-propan-2-ylhexyl) 11-methyl-11-(3-pyrrolidin-1-ylpropanoylamino)henicosanedioate |
| SMILES | CC(C)CCC(COC(=O)CCCCCCCCCC(C)(CCCCCCCCCC(=O)OCC(CCC(C)C)C(C)C)NC(=O)CCN1CCCC1)C(C)C |
| InChI | InChI=1S/C49H94N2O5/c1-40(2)28-30-44(42(5)6)38-55-47(53)26-20-16-12-10-14-18-22-33-49(9,50-46(52)32-37-51-35-24-25-36-51)34-23-19-15-11-13-17-21-27-48(54)56-39-45(43(7)8)31-29-41(3)4/h40-45H,10-39H2,1-9H3,(H,50,52) |
| InChIKey | OAPTXXPDDZPQBR-UHFFFAOYSA-N |
| XLogP | 12.87 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 36 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 791.30 |
| LogP ≤ 5 | 12.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|