C48H91NO7S2 — CID 144641650
3-pentyloctyl 2-[2-[4-[3-[2-[2-oxo-2-(3-pentyloctoxy)ethyl]sulfanylacetyl]oxypropyl]-7-pyrrolidin-1-ylheptoxy]ethylsulfanyl]acetate (PubChem CID 144641650) has the molecular formula C48H91NO7S2 and a molecular weight of 858.39 g/mol. Its IUPAC name is 3-pentyloctyl 2-[2-[4-[3-[2-[2-oxo-2-(3-pentyloctoxy)ethyl]sulfanylacetyl]oxypropyl]-7-pyrrolidin-1-ylheptoxy]ethylsulfanyl]acetate.
| Compound Name | 3-pentyloctyl 2-[2-[4-[3-[2-[2-oxo-2-(3-pentyloctoxy)ethyl]sulfanylacetyl]oxypropyl]-7-pyrrolidin-1-ylheptoxy]ethylsulfanyl]acetate |
|---|---|
| PubChem CID | 144641650 |
| Molecular Formula | C48H91NO7S2 |
| Molecular Weight | 858.39 g/mol |
| Exact Mass | 857.62 |
| IUPAC Name | 3-pentyloctyl 2-[2-[4-[3-[2-[2-oxo-2-(3-pentyloctoxy)ethyl]sulfanylacetyl]oxypropyl]-7-pyrrolidin-1-ylheptoxy]ethylsulfanyl]acetate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CSCCOCCCC(CCCOC(=O)CSCC(=O)OCCC(CCCCC)CCCCC)CCCN1CCCC1 |
| InChI | InChI=1S/C48H91NO7S2/c1-5-9-13-22-44(23-14-10-6-2)29-36-55-46(50)40-57-39-38-53-34-20-27-43(26-19-33-49-31-17-18-32-49)28-21-35-54-47(51)41-58-42-48(52)56-37-30-45(24-15-11-7-3)25-16-12-8-4/h43-45H,5-42H2,1-4H3 |
| InChIKey | JEWKXBFCAMXRHB-UHFFFAOYSA-N |
| XLogP | 12.49 |
| TPSA | 91.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 43 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 858.39 |
| LogP ≤ 5 | 12.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|