C35H66N2O5 — CID 168892136
6-[[6-(4-hexyldecoxy)-6-oxohexyl]-(3-pyrrolidin-1-ylpropanoyl)amino]hexanoic acid (PubChem CID 168892136) has the molecular formula C35H66N2O5 and a molecular weight of 594.92 g/mol. Its IUPAC name is 6-[[6-(4-hexyldecoxy)-6-oxohexyl]-(3-pyrrolidin-1-ylpropanoyl)amino]hexanoic acid.
| Compound Name | 6-[[6-(4-hexyldecoxy)-6-oxohexyl]-(3-pyrrolidin-1-ylpropanoyl)amino]hexanoic acid |
|---|---|
| PubChem CID | 168892136 |
| Molecular Formula | C35H66N2O5 |
| Molecular Weight | 594.92 g/mol |
| Exact Mass | 594.50 |
| IUPAC Name | 6-[[6-(4-hexyldecoxy)-6-oxohexyl]-(3-pyrrolidin-1-ylpropanoyl)amino]hexanoic acid |
| SMILES | CCCCCCC(CCCCCC)CCCOC(=O)CCCCCN(CCCCCC(=O)O)C(=O)CCN1CCCC1 |
| InChI | InChI=1S/C35H66N2O5/c1-3-5-7-11-20-32(21-12-8-6-4-2)22-19-31-42-35(41)24-14-10-16-29-37(28-15-9-13-23-34(39)40)33(38)25-30-36-26-17-18-27-36/h32H,3-31H2,1-2H3,(H,39,40) |
| InChIKey | RWGAVJYTOQMTHS-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 29 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.92 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|