C30H57NO5 — CID 169079693
2-[1-(4-butoxybutyl)-4-[2-oxo-2-(3-pentyloctoxy)ethyl]piperidin-4-yl]acetic acid (PubChem CID 169079693) has the molecular formula C30H57NO5 and a molecular weight of 511.79 g/mol. Its IUPAC name is 2-[1-(4-butoxybutyl)-4-[2-oxo-2-(3-pentyloctoxy)ethyl]piperidin-4-yl]acetic acid.
| Compound Name | 2-[1-(4-butoxybutyl)-4-[2-oxo-2-(3-pentyloctoxy)ethyl]piperidin-4-yl]acetic acid |
|---|---|
| PubChem CID | 169079693 |
| Molecular Formula | C30H57NO5 |
| Molecular Weight | 511.79 g/mol |
| Exact Mass | 511.42 |
| IUPAC Name | 2-[1-(4-butoxybutyl)-4-[2-oxo-2-(3-pentyloctoxy)ethyl]piperidin-4-yl]acetic acid |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CC1(CC(=O)O)CCN(CCCCOCCCC)CC1 |
| InChI | InChI=1S/C30H57NO5/c1-4-7-10-14-27(15-11-8-5-2)16-24-36-29(34)26-30(25-28(32)33)17-20-31(21-18-30)19-12-13-23-35-22-9-6-3/h27H,4-26H2,1-3H3,(H,32,33) |
| InChIKey | LRDZYRSYQVTKNL-UHFFFAOYSA-N |
| XLogP | 7.24 |
| TPSA | 76.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 23 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.79 |
| LogP ≤ 5 | 7.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|