C51H90N2O5 — CID 171548590
bis(3-pentyloctyl) 3-[9-(4-phenylmethoxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]pentanedioate (PubChem CID 171548590) has the molecular formula C51H90N2O5 and a molecular weight of 811.29 g/mol. Its IUPAC name is bis(3-pentyloctyl) 3-[9-(4-phenylmethoxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]pentanedioate.
| Compound Name | bis(3-pentyloctyl) 3-[9-(4-phenylmethoxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]pentanedioate |
|---|---|
| PubChem CID | 171548590 |
| Molecular Formula | C51H90N2O5 |
| Molecular Weight | 811.29 g/mol |
| Exact Mass | 810.68 |
| IUPAC Name | bis(3-pentyloctyl) 3-[9-(4-phenylmethoxybutyl)-3,9-diazaspiro[5.5]undecan-3-yl]pentanedioate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CC(CC(=O)OCCC(CCCCC)CCCCC)N1CCC2(CCN(CCCCOCc3ccccc3)CC2)CC1 |
| InChI | InChI=1S/C51H90N2O5/c1-5-9-14-22-45(23-15-10-6-2)28-40-57-49(54)42-48(43-50(55)58-41-29-46(24-16-11-7-3)25-17-12-8-4)53-37-32-51(33-38-53)30-35-52(36-31-51)34-20-21-39-56-44-47-26-18-13-19-27-47/h13,18-19,26-27,45-46,48H,5-12,14-17,20-25,28-44H2,1-4H3 |
| InChIKey | UPVNESSEIMSIHQ-UHFFFAOYSA-N |
| XLogP | 12.73 |
| TPSA | 68.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 34 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 811.29 |
| LogP ≤ 5 | 12.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|