C41H72O6 — CID 177206459
9-O-[2-methyl-4-(2-methyl-4-phenylmethoxybutan-2-yl)oxybutan-2-yl] 1-O-(3-pentyldecyl) nonanedioate (PubChem CID 177206459) has the molecular formula C41H72O6 and a molecular weight of 661.02 g/mol. Its IUPAC name is 9-O-[2-methyl-4-(2-methyl-4-phenylmethoxybutan-2-yl)oxybutan-2-yl] 1-O-(3-pentyldecyl) nonanedioate.
| Compound Name | 9-O-[2-methyl-4-(2-methyl-4-phenylmethoxybutan-2-yl)oxybutan-2-yl] 1-O-(3-pentyldecyl) nonanedioate |
|---|---|
| PubChem CID | 177206459 |
| Molecular Formula | C41H72O6 |
| Molecular Weight | 661.02 g/mol |
| Exact Mass | 660.53 |
| IUPAC Name | 9-O-[2-methyl-4-(2-methyl-4-phenylmethoxybutan-2-yl)oxybutan-2-yl] 1-O-(3-pentyldecyl) nonanedioate |
| SMILES | CCCCCCCC(CCCCC)CCOC(=O)CCCCCCCC(=O)OC(C)(C)CCOC(C)(C)CCOCc1ccccc1 |
| InChI | InChI=1S/C41H72O6/c1-7-9-11-13-18-24-36(23-17-10-8-2)29-32-45-38(42)27-21-14-12-15-22-28-39(43)47-41(5,6)31-34-46-40(3,4)30-33-44-35-37-25-19-16-20-26-37/h16,19-20,25-26,36H,7-15,17-18,21-24,27-35H2,1-6H3 |
| InChIKey | ODLPSZIIQRABPK-UHFFFAOYSA-N |
| XLogP | 11.32 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 661.02 |
| LogP ≤ 5 | 11.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|