C53H89NO9 — CID 177137625
4-O-[[5-[[4-oxo-4-(3-pentyloctoxy)butanoyl]oxymethyl]-3-(4-phenylmethoxybutyl)-3-azabicyclo[3.1.1]heptan-1-yl]methyl] 1-O-(3-pentyloctyl) butanedioate (PubChem CID 177137625) has the molecular formula C53H89NO9 and a molecular weight of 884.29 g/mol. Its IUPAC name is 4-O-[[5-[[4-oxo-4-(3-pentyloctoxy)butanoyl]oxymethyl]-3-(4-phenylmethoxybutyl)-3-azabicyclo[3.1.1]heptan-1-yl]methyl] 1-O-(3-pentyloctyl) butanedioate.
| Compound Name | 4-O-[[5-[[4-oxo-4-(3-pentyloctoxy)butanoyl]oxymethyl]-3-(4-phenylmethoxybutyl)-3-azabicyclo[3.1.1]heptan-1-yl]methyl] 1-O-(3-pentyloctyl) butanedioate |
|---|---|
| PubChem CID | 177137625 |
| Molecular Formula | C53H89NO9 |
| Molecular Weight | 884.29 g/mol |
| Exact Mass | 883.65 |
| IUPAC Name | 4-O-[[5-[[4-oxo-4-(3-pentyloctoxy)butanoyl]oxymethyl]-3-(4-phenylmethoxybutyl)-3-azabicyclo[3.1.1]heptan-1-yl]methyl] 1-O-(3-pentyloctyl) butanedioate |
| SMILES | CCCCCC(CCCCC)CCOC(=O)CCC(=O)OCC12CN(CCCCOCc3ccccc3)CC(COC(=O)CCC(=O)OCCC(CCCCC)CCCCC)(C1)C2 |
| InChI | InChI=1S/C53H89NO9/c1-5-9-14-22-45(23-15-10-6-2)32-36-60-48(55)28-30-50(57)62-43-52-39-53(40-52,42-54(41-52)34-20-21-35-59-38-47-26-18-13-19-27-47)44-63-51(58)31-29-49(56)61-37-33-46(24-16-11-7-3)25-17-12-8-4/h13,18-19,26-27,45-46H,5-12,14-17,20-25,28-44H2,1-4H3 |
| InChIKey | JSBUMZARAMBMGH-UHFFFAOYSA-N |
| XLogP | 12.13 |
| TPSA | 117.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 39 |
| Heavy Atoms | 63 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 884.29 |
| LogP ≤ 5 | 12.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|