C21H42N4 — CID 144642075
4-[(Z)-8-methyl-6-(4-methylpiperazin-1-yl)dec-7-en-3-yl]piperidin-3-amine (PubChem CID 144642075) has the molecular formula C21H42N4 and a molecular weight of 350.60 g/mol. Its IUPAC name is 4-[(Z)-8-methyl-6-(4-methylpiperazin-1-yl)dec-7-en-3-yl]piperidin-3-amine.
| Compound Name | 4-[(Z)-8-methyl-6-(4-methylpiperazin-1-yl)dec-7-en-3-yl]piperidin-3-amine |
|---|---|
| PubChem CID | 144642075 |
| Molecular Formula | C21H42N4 |
| Molecular Weight | 350.60 g/mol |
| Exact Mass | 350.34 |
| IUPAC Name | 4-[(Z)-8-methyl-6-(4-methylpiperazin-1-yl)dec-7-en-3-yl]piperidin-3-amine |
| SMILES | CC/C(C)=C\C(CCC(CC)C1CCNCC1N)N1CCN(C)CC1 |
| InChI | InChI=1S/C21H42N4/c1-5-17(3)15-19(25-13-11-24(4)12-14-25)8-7-18(6-2)20-9-10-23-16-21(20)22/h15,18-21,23H,5-14,16,22H2,1-4H3/b17-15- |
| InChIKey | MVEIFEPATXBEKG-ICFOKQHNSA-N |
| XLogP | 2.70 |
| TPSA | 44.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.60 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|