C23H26ClFN4O2 — CID 144642460
(1R)-8-(2-fluorophenyl)-1-methyl-9-(3-methylpiperidin-4-yl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;hydrochloride (PubChem CID 144642460) has the molecular formula C23H26ClFN4O2 and a molecular weight of 444.94 g/mol. Its IUPAC name is (1R)-8-(2-fluorophenyl)-1-methyl-9-(3-methylpiperidin-4-yl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;hydrochloride.
| Compound Name | (1R)-8-(2-fluorophenyl)-1-methyl-9-(3-methylpiperidin-4-yl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;hydrochloride |
|---|---|
| PubChem CID | 144642460 |
| Molecular Formula | C23H26ClFN4O2 |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.17 |
| IUPAC Name | (1R)-8-(2-fluorophenyl)-1-methyl-9-(3-methylpiperidin-4-yl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;hydrochloride |
| SMILES | CC1CNCCC1c1cc2c(cc1-c1ccccc1F)OCC1=NNC(=O)[C@@H](C)N12.Cl |
| InChI | InChI=1S/C23H25FN4O2.ClH/c1-13-11-25-8-7-15(13)17-9-20-21(10-18(17)16-5-3-4-6-19(16)24)30-12-22-26-27-23(29)14(2)28(20)22;/h3-6,9-10,13-15,25H,7-8,11-12H2,1-2H3,(H,27,29);1H/t13?,14-,15?;/m1./s1 |
| InChIKey | YMKXHZXAZBGBHU-NTICJULKSA-N |
| XLogP | 3.66 |
| TPSA | 65.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |