C28H33FN4O4 — CID 86727580
tert-butyl (3S,4S)-4-[(1R)-8-(2-fluorophenyl)-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]-3-methylpiperidine-1-carboxylate (PubChem CID 86727580) has the molecular formula C28H33FN4O4 and a molecular weight of 508.59 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-[(1R)-8-(2-fluorophenyl)-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-4-[(1R)-8-(2-fluorophenyl)-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 86727580 |
| Molecular Formula | C28H33FN4O4 |
| Molecular Weight | 508.59 g/mol |
| Exact Mass | 508.25 |
| IUPAC Name | tert-butyl (3S,4S)-4-[(1R)-8-(2-fluorophenyl)-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]-3-methylpiperidine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)CC[C@@H]1c1cc2c(cc1-c1ccccc1F)OCC1=NNC(=O)[C@@H](C)N12 |
| InChI | InChI=1S/C28H33FN4O4/c1-16-14-32(27(35)37-28(3,4)5)11-10-18(16)20-12-23-24(13-21(20)19-8-6-7-9-22(19)29)36-15-25-30-31-26(34)17(2)33(23)25/h6-9,12-13,16-18H,10-11,14-15H2,1-5H3,(H,31,34)/t16-,17-,18+/m1/s1 |
| InChIKey | DLQWJNNVMRFBHY-KURKYZTESA-N |
| XLogP | 4.88 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.59 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |