C27H32FN5O4 — CID 123417669
tert-butyl 3-[[8-(2-fluorophenyl)-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]-methylamino]-3-methylazetidine-1-carboxylate (PubChem CID 123417669) has the molecular formula C27H32FN5O4 and a molecular weight of 509.58 g/mol. Its IUPAC name is tert-butyl 3-[[8-(2-fluorophenyl)-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]-methylamino]-3-methylazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[[8-(2-fluorophenyl)-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]-methylamino]-3-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 123417669 |
| Molecular Formula | C27H32FN5O4 |
| Molecular Weight | 509.58 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | tert-butyl 3-[[8-(2-fluorophenyl)-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]-methylamino]-3-methylazetidine-1-carboxylate |
| SMILES | CC1C(=O)NN=C2COc3cc(-c4ccccc4F)c(N(C)C4(C)CN(C(=O)OC(C)(C)C)C4)cc3N21 |
| InChI | InChI=1S/C27H32FN5O4/c1-16-24(34)30-29-23-13-36-22-11-18(17-9-7-8-10-19(17)28)20(12-21(22)33(16)23)31(6)27(5)14-32(15-27)25(35)37-26(2,3)4/h7-12,16H,13-15H2,1-6H3,(H,30,34) |
| InChIKey | BTVVUDSODKAVOV-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 86.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.58 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|