C25H30FN5O3 — CID 144642494
(1R)-8-(2-fluorophenyl)-9-[[1-(2-hydroxypropyl)-3-methylazetidin-3-yl]-methylamino]-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one (PubChem CID 144642494) has the molecular formula C25H30FN5O3 and a molecular weight of 467.55 g/mol. Its IUPAC name is (1R)-8-(2-fluorophenyl)-9-[[1-(2-hydroxypropyl)-3-methylazetidin-3-yl]-methylamino]-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one.
| Compound Name | (1R)-8-(2-fluorophenyl)-9-[[1-(2-hydroxypropyl)-3-methylazetidin-3-yl]-methylamino]-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 144642494 |
| Molecular Formula | C25H30FN5O3 |
| Molecular Weight | 467.55 g/mol |
| Exact Mass | 467.23 |
| IUPAC Name | (1R)-8-(2-fluorophenyl)-9-[[1-(2-hydroxypropyl)-3-methylazetidin-3-yl]-methylamino]-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
| SMILES | CC(O)CN1CC(C)(N(C)c2cc3c(cc2-c2ccccc2F)OCC2=NNC(=O)[C@@H](C)N23)C1 |
| InChI | InChI=1S/C25H30FN5O3/c1-15(32)11-30-13-25(3,14-30)29(4)20-10-21-22(9-18(20)17-7-5-6-8-19(17)26)34-12-23-27-28-24(33)16(2)31(21)23/h5-10,15-16,32H,11-14H2,1-4H3,(H,28,33)/t15?,16-/m1/s1 |
| InChIKey | JCNWUKCDTIXGGQ-OEMAIJDKSA-N |
| XLogP | 2.41 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.55 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|