C29H35FN4O3 — CID 90295921
(1R)-8-(2-fluorophenyl)-1-methyl-9-[(1R)-1-[3-methyl-1-(oxan-4-ylmethyl)azetidin-3-yl]ethyl]-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one (PubChem CID 90295921) has the molecular formula C29H35FN4O3 and a molecular weight of 506.62 g/mol. Its IUPAC name is (1R)-8-(2-fluorophenyl)-1-methyl-9-[(1R)-1-[3-methyl-1-(oxan-4-ylmethyl)azetidin-3-yl]ethyl]-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one.
| Compound Name | (1R)-8-(2-fluorophenyl)-1-methyl-9-[(1R)-1-[3-methyl-1-(oxan-4-ylmethyl)azetidin-3-yl]ethyl]-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 90295921 |
| Molecular Formula | C29H35FN4O3 |
| Molecular Weight | 506.62 g/mol |
| Exact Mass | 506.27 |
| IUPAC Name | (1R)-8-(2-fluorophenyl)-1-methyl-9-[(1R)-1-[3-methyl-1-(oxan-4-ylmethyl)azetidin-3-yl]ethyl]-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
| SMILES | C[C@@H]1C(=O)NN=C2COc3cc(-c4ccccc4F)c([C@@H](C)C4(C)CN(CC5CCOCC5)C4)cc3N21 |
| InChI | InChI=1S/C29H35FN4O3/c1-18(29(3)16-33(17-29)14-20-8-10-36-11-9-20)22-12-25-26(13-23(22)21-6-4-5-7-24(21)30)37-15-27-31-32-28(35)19(2)34(25)27/h4-7,12-13,18-20H,8-11,14-17H2,1-3H3,(H,32,35)/t18-,19-/m1/s1 |
| InChIKey | ULBBAUAWYFEVSW-RTBURBONSA-N |
| XLogP | 4.38 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.62 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |