C25H29FN4O3 — CID 123642910
8-(2-fluorophenyl)-9-[1-(2-hydroxyethyl)-3-methylpiperidin-4-yl]-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one (PubChem CID 123642910) has the molecular formula C25H29FN4O3 and a molecular weight of 452.53 g/mol. Its IUPAC name is 8-(2-fluorophenyl)-9-[1-(2-hydroxyethyl)-3-methylpiperidin-4-yl]-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one.
| Compound Name | 8-(2-fluorophenyl)-9-[1-(2-hydroxyethyl)-3-methylpiperidin-4-yl]-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 123642910 |
| Molecular Formula | C25H29FN4O3 |
| Molecular Weight | 452.53 g/mol |
| Exact Mass | 452.22 |
| IUPAC Name | 8-(2-fluorophenyl)-9-[1-(2-hydroxyethyl)-3-methylpiperidin-4-yl]-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
| SMILES | CC1CN(CCO)CCC1c1cc2c(cc1-c1ccccc1F)OCC1=NNC(=O)C(C)N12 |
| InChI | InChI=1S/C25H29FN4O3/c1-15-13-29(9-10-31)8-7-17(15)19-11-22-23(12-20(19)18-5-3-4-6-21(18)26)33-14-24-27-28-25(32)16(2)30(22)24/h3-6,11-12,15-17,31H,7-10,13-14H2,1-2H3,(H,28,32) |
| InChIKey | LSYVQVQUDOBLGE-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 77.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.53 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |