C26H35FN4O2 — CID 144642587
9-(1,3-dimethylpiperidin-4-yl)-8-(2-fluorophenyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;ethane;methane (PubChem CID 144642587) has the molecular formula C26H35FN4O2 and a molecular weight of 454.59 g/mol. Its IUPAC name is 9-(1,3-dimethylpiperidin-4-yl)-8-(2-fluorophenyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;ethane;methane.
| Compound Name | 9-(1,3-dimethylpiperidin-4-yl)-8-(2-fluorophenyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;ethane;methane |
|---|---|
| PubChem CID | 144642587 |
| Molecular Formula | C26H35FN4O2 |
| Molecular Weight | 454.59 g/mol |
| Exact Mass | 454.27 |
| IUPAC Name | 9-(1,3-dimethylpiperidin-4-yl)-8-(2-fluorophenyl)-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one;ethane;methane |
| SMILES | C.CC.CC1CN(C)CCC1c1cc2c(cc1-c1ccccc1F)OCC1=NNC(=O)CN12 |
| InChI | InChI=1S/C23H25FN4O2.C2H6.CH4/c1-14-11-27(2)8-7-15(14)17-9-20-21(10-18(17)16-5-3-4-6-19(16)24)30-13-22-25-26-23(29)12-28(20)22;1-2;/h3-6,9-10,14-15H,7-8,11-13H2,1-2H3,(H,26,29);1-2H3;1H4 |
| InChIKey | WGTNMRBXZZOMFU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 57.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.59 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |