C23H26FN5O2 — CID 123939987
9-(2,5-dimethylpiperazin-1-yl)-8-(2-fluorophenyl)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one (PubChem CID 123939987) has the molecular formula C23H26FN5O2 and a molecular weight of 423.49 g/mol. Its IUPAC name is 9-(2,5-dimethylpiperazin-1-yl)-8-(2-fluorophenyl)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one.
| Compound Name | 9-(2,5-dimethylpiperazin-1-yl)-8-(2-fluorophenyl)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
|---|---|
| PubChem CID | 123939987 |
| Molecular Formula | C23H26FN5O2 |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.21 |
| IUPAC Name | 9-(2,5-dimethylpiperazin-1-yl)-8-(2-fluorophenyl)-1-methyl-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-2-one |
| SMILES | CC1CN(c2cc3c(cc2-c2ccccc2F)OCC2=NNC(=O)C(C)N23)C(C)CN1 |
| InChI | InChI=1S/C23H26FN5O2/c1-13-11-28(14(2)10-25-13)19-9-20-21(8-17(19)16-6-4-5-7-18(16)24)31-12-22-26-27-23(30)15(3)29(20)22/h4-9,13-15,25H,10-12H2,1-3H3,(H,27,30) |
| InChIKey | NQTXXAOLTNMACB-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|