C20H26BrN5O4 — CID 90220768
tert-butyl 3-[(8-bromo-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)amino]-3-methylazetidine-1-carboxylate (PubChem CID 90220768) has the molecular formula C20H26BrN5O4 and a molecular weight of 480.36 g/mol. Its IUPAC name is tert-butyl 3-[(8-bromo-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)amino]-3-methylazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(8-bromo-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)amino]-3-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 90220768 |
| Molecular Formula | C20H26BrN5O4 |
| Molecular Weight | 480.36 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | tert-butyl 3-[(8-bromo-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)amino]-3-methylazetidine-1-carboxylate |
| SMILES | CC1C(=O)NN=C2COc3cc(Br)c(NC4(C)CN(C(=O)OC(C)(C)C)C4)cc3N21 |
| InChI | InChI=1S/C20H26BrN5O4/c1-11-17(27)24-23-16-8-29-15-6-12(21)13(7-14(15)26(11)16)22-20(5)9-25(10-20)18(28)30-19(2,3)4/h6-7,11,22H,8-10H2,1-5H3,(H,24,27) |
| InChIKey | OJLMNVZGKRPATP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|