C19H24FN5O4 — CID 90220870
tert-butyl 2-[[(1S)-8-fluoro-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]amino]azetidine-1-carboxylate (PubChem CID 90220870) has the molecular formula C19H24FN5O4 and a molecular weight of 405.43 g/mol. Its IUPAC name is tert-butyl 2-[[(1S)-8-fluoro-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]amino]azetidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[(1S)-8-fluoro-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]amino]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 90220870 |
| Molecular Formula | C19H24FN5O4 |
| Molecular Weight | 405.43 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | tert-butyl 2-[[(1S)-8-fluoro-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]amino]azetidine-1-carboxylate |
| SMILES | C[C@H]1C(=O)NN=C2COc3cc(F)c(NC4CCN4C(=O)OC(C)(C)C)cc3N21 |
| InChI | InChI=1S/C19H24FN5O4/c1-10-17(26)23-22-16-9-28-14-7-11(20)12(8-13(14)25(10)16)21-15-5-6-24(15)18(27)29-19(2,3)4/h7-8,10,15,21H,5-6,9H2,1-4H3,(H,23,26)/t10-,15?/m0/s1 |
| InChIKey | VNRZFDVNARUVOG-MYHCZTBNSA-N |
| XLogP | 2.24 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.43 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|