C28H32N4O4 — CID 86727405
tert-butyl 2-benzyl-4-(1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)-3,6-dihydro-2H-pyridine-1-carboxylate (PubChem CID 86727405) has the molecular formula C28H32N4O4 and a molecular weight of 488.59 g/mol. Its IUPAC name is tert-butyl 2-benzyl-4-(1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)-3,6-dihydro-2H-pyridine-1-carboxylate.
| Compound Name | tert-butyl 2-benzyl-4-(1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
|---|---|
| PubChem CID | 86727405 |
| Molecular Formula | C28H32N4O4 |
| Molecular Weight | 488.59 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | tert-butyl 2-benzyl-4-(1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl)-3,6-dihydro-2H-pyridine-1-carboxylate |
| SMILES | CC1C(=O)NN=C2COc3ccc(C4=CCN(C(=O)OC(C)(C)C)C(Cc5ccccc5)C4)cc3N21 |
| InChI | InChI=1S/C28H32N4O4/c1-18-26(33)30-29-25-17-35-24-11-10-20(16-23(24)32(18)25)21-12-13-31(27(34)36-28(2,3)4)22(15-21)14-19-8-6-5-7-9-19/h5-12,16,18,22H,13-15,17H2,1-4H3,(H,30,33) |
| InChIKey | QDUCFGMAVQSTPD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.59 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |