C19H23AsBrN4O4 — CID 90220687
CID 90220687 (PubChem CID 90220687) has the molecular formula C19H23AsBrN4O4 and a molecular weight of 526.24 g/mol.
| Compound Name | CID 90220687 |
|---|---|
| PubChem CID | 90220687 |
| Molecular Formula | C19H23AsBrN4O4 |
| Molecular Weight | 526.24 g/mol |
| Exact Mass | 525.01 |
| IUPAC Name | — |
| SMILES | CC1C(=O)NN=C2COc3cc(Br)c([As]C4CN(C(=O)OC(C)(C)C)C4)cc3N21 |
| InChI | InChI=1S/C19H23AsBrN4O4/c1-10-17(26)23-22-16-9-28-15-6-13(21)12(5-14(15)25(10)16)20-11-7-24(8-11)18(27)29-19(2,3)4/h5-6,10-11H,7-9H2,1-4H3,(H,23,26) |
| InChIKey | CACCNNOEYUIZSH-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.24 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|