C22H26IN5O4 — CID 86727534
tert-butyl 3-[(3R)-13-iodo-3-methyl-4-oxo-9-oxa-2,5,6,15-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),6,11,13,16-pentaen-15-yl]-3-methylazetidine-1-carboxylate (PubChem CID 86727534) has the molecular formula C22H26IN5O4 and a molecular weight of 551.39 g/mol. Its IUPAC name is tert-butyl 3-[(3R)-13-iodo-3-methyl-4-oxo-9-oxa-2,5,6,15-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),6,11,13,16-pentaen-15-yl]-3-methylazetidine-1-carboxylate.
| Compound Name | tert-butyl 3-[(3R)-13-iodo-3-methyl-4-oxo-9-oxa-2,5,6,15-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),6,11,13,16-pentaen-15-yl]-3-methylazetidine-1-carboxylate |
|---|---|
| PubChem CID | 86727534 |
| Molecular Formula | C22H26IN5O4 |
| Molecular Weight | 551.39 g/mol |
| Exact Mass | 551.10 |
| IUPAC Name | tert-butyl 3-[(3R)-13-iodo-3-methyl-4-oxo-9-oxa-2,5,6,15-tetrazatetracyclo[8.7.0.02,7.012,16]heptadeca-1(10),6,11,13,16-pentaen-15-yl]-3-methylazetidine-1-carboxylate |
| SMILES | C[C@@H]1C(=O)NN=C2COc3cc4c(I)cn(C5(C)CN(C(=O)OC(C)(C)C)C5)c4cc3N21 |
| InChI | InChI=1S/C22H26IN5O4/c1-12-19(29)25-24-18-9-31-17-6-13-14(23)8-27(15(13)7-16(17)28(12)18)22(5)10-26(11-22)20(30)32-21(2,3)4/h6-8,12H,9-11H2,1-5H3,(H,25,29)/t12-/m1/s1 |
| InChIKey | ORQWKDTWZDBWHL-GFCCVEGCSA-N |
| XLogP | 3.24 |
| TPSA | 88.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.39 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|