C22H29BrN4O4 — CID 86727581
tert-butyl (3S,4S)-4-[(1R)-8-bromo-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]-3-methylpiperidine-1-carboxylate (PubChem CID 86727581) has the molecular formula C22H29BrN4O4 and a molecular weight of 493.40 g/mol. Its IUPAC name is tert-butyl (3S,4S)-4-[(1R)-8-bromo-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]-3-methylpiperidine-1-carboxylate.
| Compound Name | tert-butyl (3S,4S)-4-[(1R)-8-bromo-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]-3-methylpiperidine-1-carboxylate |
|---|---|
| PubChem CID | 86727581 |
| Molecular Formula | C22H29BrN4O4 |
| Molecular Weight | 493.40 g/mol |
| Exact Mass | 492.14 |
| IUPAC Name | tert-butyl (3S,4S)-4-[(1R)-8-bromo-1-methyl-2-oxo-3,5-dihydro-1H-[1,2,4]triazino[3,4-c][1,4]benzoxazin-9-yl]-3-methylpiperidine-1-carboxylate |
| SMILES | C[C@@H]1CN(C(=O)OC(C)(C)C)CC[C@@H]1c1cc2c(cc1Br)OCC1=NNC(=O)[C@@H](C)N12 |
| InChI | InChI=1S/C22H29BrN4O4/c1-12-10-26(21(29)31-22(3,4)5)7-6-14(12)15-8-17-18(9-16(15)23)30-11-19-24-25-20(28)13(2)27(17)19/h8-9,12-14H,6-7,10-11H2,1-5H3,(H,25,28)/t12-,13-,14+/m1/s1 |
| InChIKey | VORNXHGHLOCMJS-MCIONIFRSA-N |
| XLogP | 3.84 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |