C7H8N4 — CID 144643083
N-methyl-1H-pyrazolo[4,5-b]pyridin-5-amine (PubChem CID 144643083) has the molecular formula C7H8N4 and a molecular weight of 148.17 g/mol. Its IUPAC name is N-methyl-1H-pyrazolo[4,5-b]pyridin-5-amine.
| Compound Name | N-methyl-1H-pyrazolo[4,5-b]pyridin-5-amine |
|---|---|
| PubChem CID | 144643083 |
| Molecular Formula | C7H8N4 |
| Molecular Weight | 148.17 g/mol |
| Exact Mass | 148.07 |
| IUPAC Name | N-methyl-1H-pyrazolo[4,5-b]pyridin-5-amine |
| SMILES | CNc1ccc2[nH]ncc2n1 |
| InChI | InChI=1S/C7H8N4/c1-8-7-3-2-5-6(10-7)4-9-11-5/h2-4H,1H3,(H,8,10)(H,9,11) |
| InChIKey | YEKZIBJUPXCWIU-UHFFFAOYSA-N |
| XLogP | 1.00 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 148.17 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |