C7H9ClN4 — CID 164538697
5-chloro-1H-pyrazolo[4,3-d]pyrimidine;ethane (PubChem CID 164538697) has the molecular formula C7H9ClN4 and a molecular weight of 184.63 g/mol. Its IUPAC name is 5-chloro-1H-pyrazolo[4,3-d]pyrimidine;ethane.
| Compound Name | 5-chloro-1H-pyrazolo[4,3-d]pyrimidine;ethane |
|---|---|
| PubChem CID | 164538697 |
| Molecular Formula | C7H9ClN4 |
| Molecular Weight | 184.63 g/mol |
| Exact Mass | 184.05 |
| IUPAC Name | 5-chloro-1H-pyrazolo[4,3-d]pyrimidine;ethane |
| SMILES | CC.Clc1ncc2[nH]ncc2n1 |
| InChI | InChI=1S/C5H3ClN4.C2H6/c6-5-7-1-4-3(9-5)2-8-10-4;1-2/h1-2H,(H,8,10);1-2H3 |
| InChIKey | OHUKAIGRUZMXOU-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.63 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |