C7H5N3O — CID 59763277
1H-pyrazolo[4,5-b]pyridine-5-carbaldehyde (PubChem CID 59763277) has the molecular formula C7H5N3O and a molecular weight of 147.14 g/mol. Its IUPAC name is 1H-pyrazolo[4,5-b]pyridine-5-carbaldehyde.
| Compound Name | 1H-pyrazolo[4,5-b]pyridine-5-carbaldehyde |
|---|---|
| PubChem CID | 59763277 |
| Molecular Formula | C7H5N3O |
| Molecular Weight | 147.14 g/mol |
| Exact Mass | 147.04 |
| IUPAC Name | 1H-pyrazolo[4,5-b]pyridine-5-carbaldehyde |
| SMILES | O=Cc1ccc2[nH]ncc2n1 |
| InChI | InChI=1S/C7H5N3O/c11-4-5-1-2-6-7(9-5)3-8-10-6/h1-4H,(H,8,10) |
| InChIKey | OMARGRRTTBTNKF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.14 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|