C21H33NO4 — CID 144644484
ethyl (3S,4aR,8aR)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-6,6-dimethoxy-2,3,4,4a,5,7,8,8a-octahydroquinoline-3-carboxylate (PubChem CID 144644484) has the molecular formula C21H33NO4 and a molecular weight of 363.50 g/mol. Its IUPAC name is ethyl (3S,4aR,8aR)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-6,6-dimethoxy-2,3,4,4a,5,7,8,8a-octahydroquinoline-3-carboxylate.
| Compound Name | ethyl (3S,4aR,8aR)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-6,6-dimethoxy-2,3,4,4a,5,7,8,8a-octahydroquinoline-3-carboxylate |
|---|---|
| PubChem CID | 144644484 |
| Molecular Formula | C21H33NO4 |
| Molecular Weight | 363.50 g/mol |
| Exact Mass | 363.24 |
| IUPAC Name | ethyl (3S,4aR,8aR)-1-[(2E)-2-ethenylpenta-2,4-dienyl]-6,6-dimethoxy-2,3,4,4a,5,7,8,8a-octahydroquinoline-3-carboxylate |
| SMILES | C=C/C=C(\C=C)CN1C[C@@H](C(=O)OCC)C[C@@H]2CC(OC)(OC)CC[C@H]21 |
| InChI | InChI=1S/C21H33NO4/c1-6-9-16(7-2)14-22-15-18(20(23)26-8-3)12-17-13-21(24-4,25-5)11-10-19(17)22/h6-7,9,17-19H,1-2,8,10-15H2,3-5H3/b16-9+/t17-,18+,19-/m1/s1 |
| InChIKey | SMGHOPVMJJKXMH-NFQWHKGOSA-N |
| XLogP | 3.33 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.50 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|