C15H22BN2O3 — CID 144647429
CID 144647429 (PubChem CID 144647429) has the molecular formula C15H22BN2O3 and a molecular weight of 289.16 g/mol.
| Compound Name | CID 144647429 |
|---|---|
| PubChem CID | 144647429 |
| Molecular Formula | C15H22BN2O3 |
| Molecular Weight | 289.16 g/mol |
| Exact Mass | 289.17 |
| IUPAC Name | — |
| SMILES | C=C/C=C\C(=C/C)C(=O)NCCNC(=O)CC[B]C(C)=O |
| InChI | InChI=1S/C15H22BN2O3/c1-4-6-7-13(5-2)15(21)18-11-10-17-14(20)8-9-16-12(3)19/h4-7H,1,8-11H2,2-3H3,(H,17,20)(H,18,21)/b7-6-,13-5+ |
| InChIKey | GGXFMYCFKQWFGA-ZQNRWWJISA-N |
| XLogP | 0.97 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.16 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|