C9H11N3 — CID 144648561
(3E)-3-[(Z)-3-(methylideneamino)prop-2-enylidene]-4H-pyridin-2-amine (PubChem CID 144648561) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is (3E)-3-[(Z)-3-(methylideneamino)prop-2-enylidene]-4H-pyridin-2-amine.
| Compound Name | (3E)-3-[(Z)-3-(methylideneamino)prop-2-enylidene]-4H-pyridin-2-amine |
|---|---|
| PubChem CID | 144648561 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | (3E)-3-[(Z)-3-(methylideneamino)prop-2-enylidene]-4H-pyridin-2-amine |
| SMILES | C=N/C=C\C=C1/CC=CN=C1N |
| InChI | InChI=1S/C9H11N3/c1-11-6-2-4-8-5-3-7-12-9(8)10/h2-4,6-7H,1,5H2,(H2,10,12)/b6-2-,8-4+ |
| InChIKey | ZTRIWNOSDZWBAS-VKDZAETISA-N |
| XLogP | 1.40 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|