C12H24N4O — CID 144649695
(Z)-5,6-diamino-N-(1-methylpiperidin-4-yl)hex-5-enamide (PubChem CID 144649695) has the molecular formula C12H24N4O and a molecular weight of 240.35 g/mol. Its IUPAC name is (Z)-5,6-diamino-N-(1-methylpiperidin-4-yl)hex-5-enamide.
| Compound Name | (Z)-5,6-diamino-N-(1-methylpiperidin-4-yl)hex-5-enamide |
|---|---|
| PubChem CID | 144649695 |
| Molecular Formula | C12H24N4O |
| Molecular Weight | 240.35 g/mol |
| Exact Mass | 240.20 |
| IUPAC Name | (Z)-5,6-diamino-N-(1-methylpiperidin-4-yl)hex-5-enamide |
| SMILES | CN1CCC(NC(=O)CCC/C(N)=C/N)CC1 |
| InChI | InChI=1S/C12H24N4O/c1-16-7-5-11(6-8-16)15-12(17)4-2-3-10(14)9-13/h9,11H,2-8,13-14H2,1H3,(H,15,17)/b10-9- |
| InChIKey | BUEDHVHFZWORKU-KTKRTIGZSA-N |
| XLogP | 0.13 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.35 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |