C13H26N4O — CID 144649719
(Z)-6,7-diamino-N-(1-methylpiperidin-4-yl)hept-6-enamide (PubChem CID 144649719) has the molecular formula C13H26N4O and a molecular weight of 254.38 g/mol. Its IUPAC name is (Z)-6,7-diamino-N-(1-methylpiperidin-4-yl)hept-6-enamide.
| Compound Name | (Z)-6,7-diamino-N-(1-methylpiperidin-4-yl)hept-6-enamide |
|---|---|
| PubChem CID | 144649719 |
| Molecular Formula | C13H26N4O |
| Molecular Weight | 254.38 g/mol |
| Exact Mass | 254.21 |
| IUPAC Name | (Z)-6,7-diamino-N-(1-methylpiperidin-4-yl)hept-6-enamide |
| SMILES | CN1CCC(NC(=O)CCCC/C(N)=C/N)CC1 |
| InChI | InChI=1S/C13H26N4O/c1-17-8-6-12(7-9-17)16-13(18)5-3-2-4-11(15)10-14/h10,12H,2-9,14-15H2,1H3,(H,16,18)/b11-10- |
| InChIKey | WCPLFUYEEMGULL-KHPPLWFESA-N |
| XLogP | 0.52 |
| TPSA | 84.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.38 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|