C28H36O10 — CID 144652836
(3S,6R)-2-(hydroxymethyl)-6-[4-[2-[3-methyl-4-[(2R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]cyclopropyl]phenyl]oxane-3,4,5-triol (PubChem CID 144652836) has the molecular formula C28H36O10 and a molecular weight of 532.59 g/mol. Its IUPAC name is (3S,6R)-2-(hydroxymethyl)-6-[4-[2-[3-methyl-4-[(2R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]cyclopropyl]phenyl]oxane-3,4,5-triol.
| Compound Name | (3S,6R)-2-(hydroxymethyl)-6-[4-[2-[3-methyl-4-[(2R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]cyclopropyl]phenyl]oxane-3,4,5-triol |
|---|---|
| PubChem CID | 144652836 |
| Molecular Formula | C28H36O10 |
| Molecular Weight | 532.59 g/mol |
| Exact Mass | 532.23 |
| IUPAC Name | (3S,6R)-2-(hydroxymethyl)-6-[4-[2-[3-methyl-4-[(2R,5S)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]phenyl]cyclopropyl]phenyl]oxane-3,4,5-triol |
| SMILES | Cc1cc(C2CC2c2ccc([C@H]3OC(CO)[C@@H](O)C(O)C3O)cc2)ccc1[C@H]1OC(CO)[C@@H](O)C(O)C1O |
| InChI | InChI=1S/C28H36O10/c1-12-8-15(6-7-16(12)28-26(36)24(34)22(32)20(11-30)38-28)18-9-17(18)13-2-4-14(5-3-13)27-25(35)23(33)21(31)19(10-29)37-27/h2-8,17-36H,9-11H2,1H3/t17?,18?,19?,20?,21-,22-,23?,24?,25?,26?,27-,28-/m1/s1 |
| InChIKey | QKTUKGWZGLISPS-WSRGJAORSA-N |
| XLogP | -0.70 |
| TPSA | 180.30 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.59 |
| LogP ≤ 5 | -0.70 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 10 |