C13H22N2O — CID 144654113
acetylene;1-[(2Z,4Z)-3-methoxyhexa-2,4-dien-2-yl]piperazine (PubChem CID 144654113) has the molecular formula C13H22N2O and a molecular weight of 222.33 g/mol. Its IUPAC name is acetylene;1-[(2Z,4Z)-3-methoxyhexa-2,4-dien-2-yl]piperazine.
| Compound Name | acetylene;1-[(2Z,4Z)-3-methoxyhexa-2,4-dien-2-yl]piperazine |
|---|---|
| PubChem CID | 144654113 |
| Molecular Formula | C13H22N2O |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.17 |
| IUPAC Name | acetylene;1-[(2Z,4Z)-3-methoxyhexa-2,4-dien-2-yl]piperazine |
| SMILES | C#C.C/C=C\C(OC)=C(/C)N1CCNCC1 |
| InChI | InChI=1S/C11H20N2O.C2H2/c1-4-5-11(14-3)10(2)13-8-6-12-7-9-13;1-2/h4-5,12H,6-9H2,1-3H3;1-2H/b5-4-,11-10-; |
| InChIKey | GIUBAAQPXPORLA-ACEVCOKLSA-N |
| XLogP | 1.60 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|