C13H17FN2 — CID 144654333
4-[(2E,4E,6Z)-5-fluoroocta-2,4,6-trien-2-yl]-1,2-dimethylimidazole (PubChem CID 144654333) has the molecular formula C13H17FN2 and a molecular weight of 220.29 g/mol. Its IUPAC name is 4-[(2E,4E,6Z)-5-fluoroocta-2,4,6-trien-2-yl]-1,2-dimethylimidazole.
| Compound Name | 4-[(2E,4E,6Z)-5-fluoroocta-2,4,6-trien-2-yl]-1,2-dimethylimidazole |
|---|---|
| PubChem CID | 144654333 |
| Molecular Formula | C13H17FN2 |
| Molecular Weight | 220.29 g/mol |
| Exact Mass | 220.14 |
| IUPAC Name | 4-[(2E,4E,6Z)-5-fluoroocta-2,4,6-trien-2-yl]-1,2-dimethylimidazole |
| SMILES | C/C=C\C(F)=C/C=C(\C)c1cn(C)c(C)n1 |
| InChI | InChI=1S/C13H17FN2/c1-5-6-12(14)8-7-10(2)13-9-16(4)11(3)15-13/h5-9H,1-4H3/b6-5-,10-7+,12-8+ |
| InChIKey | DVRFPNIGPAFPIN-AUTLXHKSSA-N |
| XLogP | 3.56 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.29 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|